C17H16N2OS — CID 60958650
1H-indol-4-yl-(2-thiophen-2-ylpyrrolidin-1-yl)methanone (PubChem CID 60958650) has the molecular formula C17H16N2OS and a molecular weight of 296.39 g/mol. Its IUPAC name is 1H-indol-4-yl-(2-thiophen-2-ylpyrrolidin-1-yl)methanone.
| Compound Name | 1H-indol-4-yl-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 60958650 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1H-indol-4-yl-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1cccc2[nH]ccc12)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C17H16N2OS/c20-17(13-4-1-5-14-12(13)8-9-18-14)19-10-2-6-15(19)16-7-3-11-21-16/h1,3-5,7-9,11,15,18H,2,6,10H2 |
| InChIKey | OOLKTUDPJJYIOH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |