C16H17N5O — CID 75446127
1H-indol-4-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone (PubChem CID 75446127) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 1H-indol-4-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | 1H-indol-4-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 75446127 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1H-indol-4-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc2[nH]ccc12)N1CCCCC1c1ncn[nH]1 |
| InChI | InChI=1S/C16H17N5O/c22-16(12-4-3-5-13-11(12)7-8-17-13)21-9-2-1-6-14(21)15-18-10-19-20-15/h3-5,7-8,10,14,17H,1-2,6,9H2,(H,18,19,20) |
| InChIKey | HXJPIENNNKJCQE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |