C15H16N6O — CID 84596747
1H-indazol-7-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone (PubChem CID 84596747) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is 1H-indazol-7-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | 1H-indazol-7-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 84596747 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1H-indazol-7-yl-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc2cn[nH]c12)N1CCCCC1c1ncn[nH]1 |
| InChI | InChI=1S/C15H16N6O/c22-15(11-5-3-4-10-8-17-19-13(10)11)21-7-2-1-6-12(21)14-16-9-18-20-14/h3-5,8-9,12H,1-2,6-7H2,(H,17,19)(H,16,18,20) |
| InChIKey | SMDGLAYZTAQMLC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |