C16H16N6O — CID 129487916
quinoxalin-5-yl-[(2S)-2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone (PubChem CID 129487916) has the molecular formula C16H16N6O and a molecular weight of 308.34 g/mol. Its IUPAC name is quinoxalin-5-yl-[(2S)-2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone.
| Compound Name | quinoxalin-5-yl-[(2S)-2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 129487916 |
| Molecular Formula | C16H16N6O |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | quinoxalin-5-yl-[(2S)-2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc2nccnc12)N1CCCC[C@H]1c1ncn[nH]1 |
| InChI | InChI=1S/C16H16N6O/c23-16(11-4-3-5-12-14(11)18-8-7-17-12)22-9-2-1-6-13(22)15-19-10-20-21-15/h3-5,7-8,10,13H,1-2,6,9H2,(H,19,20,21)/t13-/m0/s1 |
| InChIKey | SFSWOGUZZVZNPE-ZDUSSCGKSA-N |
| XLogP | 2.12 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |