C17H17N3OS — CID 56825846
N-(1H-indol-4-yl)-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 56825846) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is N-(1H-indol-4-yl)-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | N-(1H-indol-4-yl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 56825846 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-(1H-indol-4-yl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc2[nH]ccc12)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C17H17N3OS/c21-17(19-14-5-1-4-13-12(14)8-9-18-13)20-10-2-6-15(20)16-7-3-11-22-16/h1,3-5,7-9,11,15,18H,2,6,10H2,(H,19,21) |
| InChIKey | OPDOYNZGAJXLRF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |