C17H18BrFN2OS — CID 22586894
N-(4-bromo-2-fluorophenyl)-2-thiophen-2-ylazepane-1-carboxamide (PubChem CID 22586894) has the molecular formula C17H18BrFN2OS and a molecular weight of 397.31 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-2-thiophen-2-ylazepane-1-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-2-thiophen-2-ylazepane-1-carboxamide |
|---|---|
| PubChem CID | 22586894 |
| Molecular Formula | C17H18BrFN2OS |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-2-thiophen-2-ylazepane-1-carboxamide |
| SMILES | O=C(Nc1ccc(Br)cc1F)N1CCCCCC1c1cccs1 |
| InChI | InChI=1S/C17H18BrFN2OS/c18-12-7-8-14(13(19)11-12)20-17(22)21-9-3-1-2-5-15(21)16-6-4-10-23-16/h4,6-8,10-11,15H,1-3,5,9H2,(H,20,22) |
| InChIKey | OWXFLTQEOJRQMM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |