C19H24N2OS — CID 92503165
(2S)-N-(2-ethylphenyl)-2-thiophen-2-ylazepane-1-carboxamide (PubChem CID 92503165) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is (2S)-N-(2-ethylphenyl)-2-thiophen-2-ylazepane-1-carboxamide.
| Compound Name | (2S)-N-(2-ethylphenyl)-2-thiophen-2-ylazepane-1-carboxamide |
|---|---|
| PubChem CID | 92503165 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (2S)-N-(2-ethylphenyl)-2-thiophen-2-ylazepane-1-carboxamide |
| SMILES | CCc1ccccc1NC(=O)N1CCCCC[C@H]1c1cccs1 |
| InChI | InChI=1S/C19H24N2OS/c1-2-15-9-5-6-10-16(15)20-19(22)21-13-7-3-4-11-17(21)18-12-8-14-23-18/h5-6,8-10,12,14,17H,2-4,7,11,13H2,1H3,(H,20,22)/t17-/m0/s1 |
| InChIKey | IRYIDAVXVSLPTO-KRWDZBQOSA-N |
| XLogP | 5.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |