C16H17ClN2OS — CID 92500015
(2S)-N-(2-chloro-4-methylphenyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 92500015) has the molecular formula C16H17ClN2OS and a molecular weight of 320.85 g/mol. Its IUPAC name is (2S)-N-(2-chloro-4-methylphenyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-(2-chloro-4-methylphenyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 92500015 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (2S)-N-(2-chloro-4-methylphenyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCC[C@H]2c2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2OS/c1-11-6-7-13(12(17)10-11)18-16(20)19-8-2-4-14(19)15-5-3-9-21-15/h3,5-7,9-10,14H,2,4,8H2,1H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | MSDDLTAJRLYOFC-AWEZNQCLSA-N |
| XLogP | 5.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |