C17H20N2S2 — CID 8658824
(2R)-N-(3,5-dimethylphenyl)-2-thiophen-2-ylpyrrolidine-1-carbothioamide (PubChem CID 8658824) has the molecular formula C17H20N2S2 and a molecular weight of 316.50 g/mol. Its IUPAC name is (2R)-N-(3,5-dimethylphenyl)-2-thiophen-2-ylpyrrolidine-1-carbothioamide.
| Compound Name | (2R)-N-(3,5-dimethylphenyl)-2-thiophen-2-ylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 8658824 |
| Molecular Formula | C17H20N2S2 |
| Molecular Weight | 316.50 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (2R)-N-(3,5-dimethylphenyl)-2-thiophen-2-ylpyrrolidine-1-carbothioamide |
| SMILES | Cc1cc(C)cc(NC(=S)N2CCC[C@@H]2c2cccs2)c1 |
| InChI | InChI=1S/C17H20N2S2/c1-12-9-13(2)11-14(10-12)18-17(20)19-7-3-5-15(19)16-6-4-8-21-16/h4,6,8-11,15H,3,5,7H2,1-2H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | JIXXPZQSFHHYNN-OAHLLOKOSA-N |
| XLogP | 4.90 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|