C16H18N2OS2 — CID 8658799
(2S)-N-(4-methoxyphenyl)-2-thiophen-2-ylpyrrolidine-1-carbothioamide (PubChem CID 8658799) has the molecular formula C16H18N2OS2 and a molecular weight of 318.47 g/mol. Its IUPAC name is (2S)-N-(4-methoxyphenyl)-2-thiophen-2-ylpyrrolidine-1-carbothioamide.
| Compound Name | (2S)-N-(4-methoxyphenyl)-2-thiophen-2-ylpyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 8658799 |
| Molecular Formula | C16H18N2OS2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (2S)-N-(4-methoxyphenyl)-2-thiophen-2-ylpyrrolidine-1-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCC[C@H]2c2cccs2)cc1 |
| InChI | InChI=1S/C16H18N2OS2/c1-19-13-8-6-12(7-9-13)17-16(20)18-10-2-4-14(18)15-5-3-11-21-15/h3,5-9,11,14H,2,4,10H2,1H3,(H,17,20)/t14-/m0/s1 |
| InChIKey | HHEYIPFFONABHB-AWEZNQCLSA-N |
| XLogP | 4.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|