C23H24N2O4S2 — CID 55349268
N-(4-methoxyphenyl)-4-methyl-3-(2-thiophen-2-ylpyrrolidine-1-carbonyl)benzenesulfonamide (PubChem CID 55349268) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-methyl-3-(2-thiophen-2-ylpyrrolidine-1-carbonyl)benzenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-4-methyl-3-(2-thiophen-2-ylpyrrolidine-1-carbonyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55349268 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | N-(4-methoxyphenyl)-4-methyl-3-(2-thiophen-2-ylpyrrolidine-1-carbonyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)N3CCCC3c3cccs3)c2)cc1 |
| InChI | InChI=1S/C23H24N2O4S2/c1-16-7-12-19(31(27,28)24-17-8-10-18(29-2)11-9-17)15-20(16)23(26)25-13-3-5-21(25)22-6-4-14-30-22/h4,6-12,14-15,21,24H,3,5,13H2,1-2H3 |
| InChIKey | QWNMYITVYTULID-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |