C17H20N2O3S2 — CID 55556761
N-[2-methyl-5-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenyl]methanesulfonamide (PubChem CID 55556761) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is N-[2-methyl-5-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenyl]methanesulfonamide.
| Compound Name | N-[2-methyl-5-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 55556761 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[2-methyl-5-(2-thiophen-2-ylpyrrolidine-1-carbonyl)phenyl]methanesulfonamide |
| SMILES | Cc1ccc(C(=O)N2CCCC2c2cccs2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C17H20N2O3S2/c1-12-7-8-13(11-14(12)18-24(2,21)22)17(20)19-9-3-5-15(19)16-6-4-10-23-16/h4,6-8,10-11,15,18H,3,5,9H2,1-2H3 |
| InChIKey | YMDIAAWMCNRATB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |