C18H23N3O4S2 — CID 52766431
(2R)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 52766431) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (2R)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 52766431 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (2R)-N-[4-(ethylsulfonylamino)-3-methoxyphenyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | CCS(=O)(=O)Nc1ccc(NC(=O)N2CCC[C@@H]2c2cccs2)cc1OC |
| InChI | InChI=1S/C18H23N3O4S2/c1-3-27(23,24)20-14-9-8-13(12-16(14)25-2)19-18(22)21-10-4-6-15(21)17-7-5-11-26-17/h5,7-9,11-12,15,20H,3-4,6,10H2,1-2H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | FNHMZUMAADCMQF-OAHLLOKOSA-N |
| XLogP | 3.89 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |