C19H23N3O3S — CID 48643647
N-[3-(2-methoxypropanoylamino)phenyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 48643647) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[3-(2-methoxypropanoylamino)phenyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | N-[3-(2-methoxypropanoylamino)phenyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 48643647 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-[3-(2-methoxypropanoylamino)phenyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | COC(C)C(=O)Nc1cccc(NC(=O)N2CCCC2c2cccs2)c1 |
| InChI | InChI=1S/C19H23N3O3S/c1-13(25-2)18(23)20-14-6-3-7-15(12-14)21-19(24)22-10-4-8-16(22)17-9-5-11-26-17/h3,5-7,9,11-13,16H,4,8,10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | ZVAQFCIENHIWPN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |