C15H17N3O2S — CID 94028395
(2R)-N-(6-methoxy-3-pyridinyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 94028395) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is (2R)-N-(6-methoxy-3-pyridinyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | (2R)-N-(6-methoxy-3-pyridinyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 94028395 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (2R)-N-(6-methoxy-3-pyridinyl)-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC[C@@H]2c2cccs2)cn1 |
| InChI | InChI=1S/C15H17N3O2S/c1-20-14-7-6-11(10-16-14)17-15(19)18-8-2-4-12(18)13-5-3-9-21-13/h3,5-7,9-10,12H,2,4,8H2,1H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | RJORZVKCDPDJHJ-GFCCVEGCSA-N |
| XLogP | 3.52 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |