C18H27N3O2S — CID 97012952
(2S)-N-[3-(azepan-1-yl)-3-oxopropyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide (PubChem CID 97012952) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is (2S)-N-[3-(azepan-1-yl)-3-oxopropyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide.
| Compound Name | (2S)-N-[3-(azepan-1-yl)-3-oxopropyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 97012952 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | (2S)-N-[3-(azepan-1-yl)-3-oxopropyl]-2-thiophen-2-ylpyrrolidine-1-carboxamide |
| SMILES | O=C(CCNC(=O)N1CCC[C@H]1c1cccs1)N1CCCCCC1 |
| InChI | InChI=1S/C18H27N3O2S/c22-17(20-11-3-1-2-4-12-20)9-10-19-18(23)21-13-5-7-15(21)16-8-6-14-24-16/h6,8,14-15H,1-5,7,9-13H2,(H,19,23)/t15-/m0/s1 |
| InChIKey | XBYUJIUTSCYBRC-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |