C15H21N3O2S — CID 94184145
(3S)-3-[(2S)-2-thiophen-2-ylpyrrolidine-1-carbonyl]piperidine-1-carboxamide (PubChem CID 94184145) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is (3S)-3-[(2S)-2-thiophen-2-ylpyrrolidine-1-carbonyl]piperidine-1-carboxamide.
| Compound Name | (3S)-3-[(2S)-2-thiophen-2-ylpyrrolidine-1-carbonyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 94184145 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (3S)-3-[(2S)-2-thiophen-2-ylpyrrolidine-1-carbonyl]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC[C@H](C(=O)N2CCC[C@H]2c2cccs2)C1 |
| InChI | InChI=1S/C15H21N3O2S/c16-15(20)17-7-1-4-11(10-17)14(19)18-8-2-5-12(18)13-6-3-9-21-13/h3,6,9,11-12H,1-2,4-5,7-8,10H2,(H2,16,20)/t11-,12-/m0/s1 |
| InChIKey | AQFBZPPUNHZXDO-RYUDHWBXSA-N |
| XLogP | 2.20 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |