C19H22N2O3S — CID 134048550
[1-(furan-3-carbonyl)piperidin-4-yl]-(2-thiophen-2-ylpyrrolidin-1-yl)methanone (PubChem CID 134048550) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is [1-(furan-3-carbonyl)piperidin-4-yl]-(2-thiophen-2-ylpyrrolidin-1-yl)methanone.
| Compound Name | [1-(furan-3-carbonyl)piperidin-4-yl]-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 134048550 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [1-(furan-3-carbonyl)piperidin-4-yl]-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccoc1)N1CCC(C(=O)N2CCCC2c2cccs2)CC1 |
| InChI | InChI=1S/C19H22N2O3S/c22-18(15-7-11-24-13-15)20-9-5-14(6-10-20)19(23)21-8-1-3-16(21)17-4-2-12-25-17/h2,4,7,11-14,16H,1,3,5-6,8-10H2 |
| InChIKey | AMNBLLAVJDQVDD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |