C15H19NO3S — CID 103550294
3-(2-thiophen-2-ylpyrrolidine-1-carbonyl)cyclopentane-1-carboxylic acid (PubChem CID 103550294) has the molecular formula C15H19NO3S and a molecular weight of 293.39 g/mol. Its IUPAC name is 3-(2-thiophen-2-ylpyrrolidine-1-carbonyl)cyclopentane-1-carboxylic acid.
| Compound Name | 3-(2-thiophen-2-ylpyrrolidine-1-carbonyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 103550294 |
| Molecular Formula | C15H19NO3S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-(2-thiophen-2-ylpyrrolidine-1-carbonyl)cyclopentane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CCCC2c2cccs2)C1 |
| InChI | InChI=1S/C15H19NO3S/c17-14(10-5-6-11(9-10)15(18)19)16-7-1-3-12(16)13-4-2-8-20-13/h2,4,8,10-12H,1,3,5-7,9H2,(H,18,19) |
| InChIKey | XABXJULNHDABQR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |