C17H20N2O3S — CID 134048432
1-(furan-3-carbonyl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide (PubChem CID 134048432) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is 1-(furan-3-carbonyl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-(furan-3-carbonyl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134048432 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 1-(furan-3-carbonyl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)C1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C17H20N2O3S/c20-16(18-7-3-15-2-1-11-23-15)13-4-8-19(9-5-13)17(21)14-6-10-22-12-14/h1-2,6,10-13H,3-5,7-9H2,(H,18,20) |
| InChIKey | NNOFIRPJCMSRIH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |