C23H26N4O4S — CID 60600096
1-(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide (PubChem CID 60600096) has the molecular formula C23H26N4O4S and a molecular weight of 454.55 g/mol. Its IUPAC name is 1-(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60600096 |
| Molecular Formula | C23H26N4O4S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1-(1-ethyl-2,3-dioxo-4H-quinoxaline-6-carbonyl)-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
| SMILES | CCn1c(=O)c(=O)[nH]c2cc(C(=O)N3CCC(C(=O)NCCc4cccs4)CC3)ccc21 |
| InChI | InChI=1S/C23H26N4O4S/c1-2-27-19-6-5-16(14-18(19)25-21(29)23(27)31)22(30)26-11-8-15(9-12-26)20(28)24-10-7-17-4-3-13-32-17/h3-6,13-15H,2,7-12H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | IKMYMUSUADRITC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|