C27H27N3O3S — CID 60599884
1-[2-(9-oxoacridin-10-yl)acetyl]-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide (PubChem CID 60599884) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is 1-[2-(9-oxoacridin-10-yl)acetyl]-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide.
| Compound Name | 1-[2-(9-oxoacridin-10-yl)acetyl]-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60599884 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 1-[2-(9-oxoacridin-10-yl)acetyl]-N-(2-thiophen-2-ylethyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCc1cccs1)C1CCN(C(=O)Cn2c3ccccc3c(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C27H27N3O3S/c31-25(29-15-12-19(13-16-29)27(33)28-14-11-20-6-5-17-34-20)18-30-23-9-3-1-7-21(23)26(32)22-8-2-4-10-24(22)30/h1-10,17,19H,11-16,18H2,(H,28,33) |
| InChIKey | QRQFPJLQQMDZDD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|