C23H20N2O2S — CID 25345728
N-cyclopropyl-2-(9-oxoacridin-10-yl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 25345728) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-cyclopropyl-2-(9-oxoacridin-10-yl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-cyclopropyl-2-(9-oxoacridin-10-yl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 25345728 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-cyclopropyl-2-(9-oxoacridin-10-yl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C23H20N2O2S/c26-22(24(16-11-12-16)14-17-6-5-13-28-17)15-25-20-9-3-1-7-18(20)23(27)19-8-2-4-10-21(19)25/h1-10,13,16H,11-12,14-15H2 |
| InChIKey | JTIQGACVJIYXAC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|