C13H16N2O5S — CID 63647136
2-[carboxymethyl-[cyclopropyl(thiophen-2-ylmethyl)carbamoyl]amino]acetic acid (PubChem CID 63647136) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-[carboxymethyl-[cyclopropyl(thiophen-2-ylmethyl)carbamoyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[cyclopropyl(thiophen-2-ylmethyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 63647136 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 2-[carboxymethyl-[cyclopropyl(thiophen-2-ylmethyl)carbamoyl]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(=O)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C13H16N2O5S/c16-11(17)7-14(8-12(18)19)13(20)15(9-3-4-9)6-10-2-1-5-21-10/h1-2,5,9H,3-4,6-8H2,(H,16,17)(H,18,19) |
| InChIKey | ARZFFSCKUPRVOD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |