C13H18N2O3S — CID 61197167
3-[cyclopropyl-[methyl(thiophen-2-ylmethyl)carbamoyl]amino]propanoic acid (PubChem CID 61197167) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is 3-[cyclopropyl-[methyl(thiophen-2-ylmethyl)carbamoyl]amino]propanoic acid.
| Compound Name | 3-[cyclopropyl-[methyl(thiophen-2-ylmethyl)carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 61197167 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-[cyclopropyl-[methyl(thiophen-2-ylmethyl)carbamoyl]amino]propanoic acid |
| SMILES | CN(Cc1cccs1)C(=O)N(CCC(=O)O)C1CC1 |
| InChI | InChI=1S/C13H18N2O3S/c1-14(9-11-3-2-8-19-11)13(18)15(10-4-5-10)7-6-12(16)17/h2-3,8,10H,4-7,9H2,1H3,(H,16,17) |
| InChIKey | KCGTYZVIGCADPN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |