C14H19NO2S — CID 52571989
N-cyclopropyl-N-(thiophen-2-ylmethyl)oxane-4-carboxamide (PubChem CID 52571989) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is N-cyclopropyl-N-(thiophen-2-ylmethyl)oxane-4-carboxamide.
| Compound Name | N-cyclopropyl-N-(thiophen-2-ylmethyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 52571989 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | N-cyclopropyl-N-(thiophen-2-ylmethyl)oxane-4-carboxamide |
| SMILES | O=C(C1CCOCC1)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C14H19NO2S/c16-14(11-5-7-17-8-6-11)15(12-3-4-12)10-13-2-1-9-18-13/h1-2,9,11-12H,3-8,10H2 |
| InChIKey | SSNKBFCYBWVOAZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |