C17H25NO2S2 — CID 90610601
2-cyclopentylsulfanyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 90610601) has the molecular formula C17H25NO2S2 and a molecular weight of 339.53 g/mol. Its IUPAC name is 2-cyclopentylsulfanyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-cyclopentylsulfanyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 90610601 |
| Molecular Formula | C17H25NO2S2 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-cyclopentylsulfanyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CSC1CCCC1)N(Cc1cccs1)C1CCOCC1 |
| InChI | InChI=1S/C17H25NO2S2/c19-17(13-22-15-4-1-2-5-15)18(12-16-6-3-11-21-16)14-7-9-20-10-8-14/h3,6,11,14-15H,1-2,4-5,7-10,12-13H2 |
| InChIKey | OBFYBBFFIPRTRJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |