C21H27NO4S2 — CID 73167808
N-(oxan-4-yl)-2-(4-propan-2-ylsulfonylphenyl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 73167808) has the molecular formula C21H27NO4S2 and a molecular weight of 421.58 g/mol. Its IUPAC name is N-(oxan-4-yl)-2-(4-propan-2-ylsulfonylphenyl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-(oxan-4-yl)-2-(4-propan-2-ylsulfonylphenyl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 73167808 |
| Molecular Formula | C21H27NO4S2 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-(oxan-4-yl)-2-(4-propan-2-ylsulfonylphenyl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CC(C)S(=O)(=O)c1ccc(CC(=O)N(Cc2cccs2)C2CCOCC2)cc1 |
| InChI | InChI=1S/C21H27NO4S2/c1-16(2)28(24,25)20-7-5-17(6-8-20)14-21(23)22(15-19-4-3-13-27-19)18-9-11-26-12-10-18/h3-8,13,16,18H,9-12,14-15H2,1-2H3 |
| InChIKey | KNKVPRAOEFYUIW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |