C19H20F3NOS — CID 159758558
N-cyclopentyl-N-(thiophen-2-ylmethyl)-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 159758558) has the molecular formula C19H20F3NOS and a molecular weight of 367.44 g/mol. Its IUPAC name is N-cyclopentyl-N-(thiophen-2-ylmethyl)-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-cyclopentyl-N-(thiophen-2-ylmethyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 159758558 |
| Molecular Formula | C19H20F3NOS |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-cyclopentyl-N-(thiophen-2-ylmethyl)-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)N(Cc1cccs1)C1CCCC1 |
| InChI | InChI=1S/C19H20F3NOS/c20-19(21,22)15-9-7-14(8-10-15)12-18(24)23(16-4-1-2-5-16)13-17-6-3-11-25-17/h3,6-11,16H,1-2,4-5,12-13H2 |
| InChIKey | NEOSQTWVMNCEFY-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |