C19H28FNO2S — CID 90227756
N-cyclohexyl-2-(3-fluorocyclohexyl)oxy-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 90227756) has the molecular formula C19H28FNO2S and a molecular weight of 353.50 g/mol. Its IUPAC name is N-cyclohexyl-2-(3-fluorocyclohexyl)oxy-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | N-cyclohexyl-2-(3-fluorocyclohexyl)oxy-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 90227756 |
| Molecular Formula | C19H28FNO2S |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | N-cyclohexyl-2-(3-fluorocyclohexyl)oxy-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(COC1CCCC(F)C1)N(Cc1cccs1)C1CCCCC1 |
| InChI | InChI=1S/C19H28FNO2S/c20-15-6-4-9-17(12-15)23-14-19(22)21(13-18-10-5-11-24-18)16-7-2-1-3-8-16/h5,10-11,15-17H,1-4,6-9,12-14H2 |
| InChIKey | QSKJRNMESWXJGI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |