C20H25NOS — CID 157468797
N-cyclopentyl-4-phenyl-N-(thiophen-2-ylmethyl)butanamide (PubChem CID 157468797) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is N-cyclopentyl-4-phenyl-N-(thiophen-2-ylmethyl)butanamide.
| Compound Name | N-cyclopentyl-4-phenyl-N-(thiophen-2-ylmethyl)butanamide |
|---|---|
| PubChem CID | 157468797 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-cyclopentyl-4-phenyl-N-(thiophen-2-ylmethyl)butanamide |
| SMILES | O=C(CCCc1ccccc1)N(Cc1cccs1)C1CCCC1 |
| InChI | InChI=1S/C20H25NOS/c22-20(14-6-10-17-8-2-1-3-9-17)21(18-11-4-5-12-18)16-19-13-7-15-23-19/h1-3,7-9,13,15,18H,4-6,10-12,14,16H2 |
| InChIKey | BUTYOUBOAUCDSF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |