C21H27NO2S — CID 90611027
N-(oxan-4-yl)-4-phenyl-N-(2-thiophen-2-ylethyl)butanamide (PubChem CID 90611027) has the molecular formula C21H27NO2S and a molecular weight of 357.52 g/mol. Its IUPAC name is N-(oxan-4-yl)-4-phenyl-N-(2-thiophen-2-ylethyl)butanamide.
| Compound Name | N-(oxan-4-yl)-4-phenyl-N-(2-thiophen-2-ylethyl)butanamide |
|---|---|
| PubChem CID | 90611027 |
| Molecular Formula | C21H27NO2S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | N-(oxan-4-yl)-4-phenyl-N-(2-thiophen-2-ylethyl)butanamide |
| SMILES | O=C(CCCc1ccccc1)N(CCc1cccs1)C1CCOCC1 |
| InChI | InChI=1S/C21H27NO2S/c23-21(10-4-8-18-6-2-1-3-7-18)22(19-12-15-24-16-13-19)14-11-20-9-5-17-25-20/h1-3,5-7,9,17,19H,4,8,10-16H2 |
| InChIKey | LLTGPAFVXCBMMP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |