C18H25NO2S — CID 99873308
(1R)-N-(oxan-4-yl)-N-(2-thiophen-2-ylethyl)cyclohex-3-ene-1-carboxamide (PubChem CID 99873308) has the molecular formula C18H25NO2S and a molecular weight of 319.47 g/mol. Its IUPAC name is (1R)-N-(oxan-4-yl)-N-(2-thiophen-2-ylethyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-(oxan-4-yl)-N-(2-thiophen-2-ylethyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 99873308 |
| Molecular Formula | C18H25NO2S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (1R)-N-(oxan-4-yl)-N-(2-thiophen-2-ylethyl)cyclohex-3-ene-1-carboxamide |
| SMILES | O=C([C@H]1CC=CCC1)N(CCc1cccs1)C1CCOCC1 |
| InChI | InChI=1S/C18H25NO2S/c20-18(15-5-2-1-3-6-15)19(16-9-12-21-13-10-16)11-8-17-7-4-14-22-17/h1-2,4,7,14-16H,3,5-6,8-13H2/t15-/m0/s1 |
| InChIKey | FAZMRVIXVWOSRS-HNNXBMFYSA-N |
| XLogP | 3.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|