C22H25BrN2O3S — CID 90610938
1-(3-bromophenyl)-N-(oxan-4-yl)-5-oxo-N-(2-thiophen-2-ylethyl)pyrrolidine-3-carboxamide (PubChem CID 90610938) has the molecular formula C22H25BrN2O3S and a molecular weight of 477.42 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-(oxan-4-yl)-5-oxo-N-(2-thiophen-2-ylethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-(oxan-4-yl)-5-oxo-N-(2-thiophen-2-ylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90610938 |
| Molecular Formula | C22H25BrN2O3S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 1-(3-bromophenyl)-N-(oxan-4-yl)-5-oxo-N-(2-thiophen-2-ylethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)N(CCc2cccs2)C2CCOCC2)CN1c1cccc(Br)c1 |
| InChI | InChI=1S/C22H25BrN2O3S/c23-17-3-1-4-19(14-17)25-15-16(13-21(25)26)22(27)24(18-7-10-28-11-8-18)9-6-20-5-2-12-29-20/h1-5,12,14,16,18H,6-11,13,15H2 |
| InChIKey | CDCYUFXWVUPWPH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |