C20H20BrN3O2 — CID 42953091
1-(3-bromophenyl)-N-cyclopropyl-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 42953091) has the molecular formula C20H20BrN3O2 and a molecular weight of 414.30 g/mol. Its IUPAC name is 1-(3-bromophenyl)-N-cyclopropyl-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-bromophenyl)-N-cyclopropyl-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 42953091 |
| Molecular Formula | C20H20BrN3O2 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 1-(3-bromophenyl)-N-cyclopropyl-5-oxo-N-(pyridin-3-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C1CC(C(=O)N(Cc2cccnc2)C2CC2)CN1c1cccc(Br)c1 |
| InChI | InChI=1S/C20H20BrN3O2/c21-16-4-1-5-18(10-16)23-13-15(9-19(23)25)20(26)24(17-6-7-17)12-14-3-2-8-22-11-14/h1-5,8,10-11,15,17H,6-7,9,12-13H2 |
| InChIKey | HHXBLQKKZLXECL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |