C18H27NO2S — CID 90610659
2-cyclohexyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 90610659) has the molecular formula C18H27NO2S and a molecular weight of 321.49 g/mol. Its IUPAC name is 2-cyclohexyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-cyclohexyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 90610659 |
| Molecular Formula | C18H27NO2S |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | 2-cyclohexyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CC1CCCCC1)N(Cc1cccs1)C1CCOCC1 |
| InChI | InChI=1S/C18H27NO2S/c20-18(13-15-5-2-1-3-6-15)19(14-17-7-4-12-22-17)16-8-10-21-11-9-16/h4,7,12,15-16H,1-3,5-6,8-11,13-14H2 |
| InChIKey | YOIYHCVRNJYETC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |