C14H20OS — CID 114973276
1-cyclohexyl-4-thiophen-2-ylbutan-2-one (PubChem CID 114973276) has the molecular formula C14H20OS and a molecular weight of 236.38 g/mol. Its IUPAC name is 1-cyclohexyl-4-thiophen-2-ylbutan-2-one.
| Compound Name | 1-cyclohexyl-4-thiophen-2-ylbutan-2-one |
|---|---|
| PubChem CID | 114973276 |
| Molecular Formula | C14H20OS |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-cyclohexyl-4-thiophen-2-ylbutan-2-one |
| SMILES | O=C(CCc1cccs1)CC1CCCCC1 |
| InChI | InChI=1S/C14H20OS/c15-13(8-9-14-7-4-10-16-14)11-12-5-2-1-3-6-12/h4,7,10,12H,1-3,5-6,8-9,11H2 |
| InChIKey | YTHROKHSYZDLJV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |