C13H19NOS — CID 116559062
1-(cyclopentylamino)-4-thiophen-2-ylbutan-2-one (PubChem CID 116559062) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 1-(cyclopentylamino)-4-thiophen-2-ylbutan-2-one.
| Compound Name | 1-(cyclopentylamino)-4-thiophen-2-ylbutan-2-one |
|---|---|
| PubChem CID | 116559062 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 1-(cyclopentylamino)-4-thiophen-2-ylbutan-2-one |
| SMILES | O=C(CCc1cccs1)CNC1CCCC1 |
| InChI | InChI=1S/C13H19NOS/c15-12(7-8-13-6-3-9-16-13)10-14-11-4-1-2-5-11/h3,6,9,11,14H,1-2,4-5,7-8,10H2 |
| InChIKey | TWHCOUMESNFSBL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |