C11H14OS — CID 64982146
1-cyclobutyl-3-thiophen-2-ylpropan-1-one (PubChem CID 64982146) has the molecular formula C11H14OS and a molecular weight of 194.30 g/mol. Its IUPAC name is 1-cyclobutyl-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-cyclobutyl-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 64982146 |
| Molecular Formula | C11H14OS |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 1-cyclobutyl-3-thiophen-2-ylpropan-1-one |
| SMILES | O=C(CCc1cccs1)C1CCC1 |
| InChI | InChI=1S/C11H14OS/c12-11(9-3-1-4-9)7-6-10-5-2-8-13-10/h2,5,8-9H,1,3-4,6-7H2 |
| InChIKey | CRDSZICADOGITA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |