C15H22OS — CID 105104895
1-(4-methylcyclohexyl)-4-thiophen-2-ylbutan-1-one (PubChem CID 105104895) has the molecular formula C15H22OS and a molecular weight of 250.41 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-(4-methylcyclohexyl)-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 105104895 |
| Molecular Formula | C15H22OS |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 1-(4-methylcyclohexyl)-4-thiophen-2-ylbutan-1-one |
| SMILES | CC1CCC(C(=O)CCCc2cccs2)CC1 |
| InChI | InChI=1S/C15H22OS/c1-12-7-9-13(10-8-12)15(16)6-2-4-14-5-3-11-17-14/h3,5,11-13H,2,4,6-10H2,1H3 |
| InChIKey | UWUROOQMNHABQR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |