C13H16F2OS — CID 105101468
1-(4,4-difluorocyclohexyl)-3-thiophen-2-ylpropan-1-one (PubChem CID 105101468) has the molecular formula C13H16F2OS and a molecular weight of 258.33 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-(4,4-difluorocyclohexyl)-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 105101468 |
| Molecular Formula | C13H16F2OS |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-3-thiophen-2-ylpropan-1-one |
| SMILES | O=C(CCc1cccs1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H16F2OS/c14-13(15)7-5-10(6-8-13)12(16)4-3-11-2-1-9-17-11/h1-2,9-10H,3-8H2 |
| InChIKey | UQRVEXMVMSWEGC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |