C16H23NO3S — CID 120677312
cis-(1R,3S)-3-(6-thiophen-2-ylhexanoylamino)cyclopentane-1-carboxylic acid (PubChem CID 120677312) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is cis-(1R,3S)-3-(6-thiophen-2-ylhexanoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(6-thiophen-2-ylhexanoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120677312 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | cis-(1R,3S)-3-(6-thiophen-2-ylhexanoylamino)cyclopentane-1-carboxylic acid |
| SMILES | O=C(CCCCCc1cccs1)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C16H23NO3S/c18-15(17-13-9-8-12(11-13)16(19)20)7-3-1-2-5-14-6-4-10-21-14/h4,6,10,12-13H,1-3,5,7-9,11H2,(H,17,18)(H,19,20)/t12-,13+/m1/s1 |
| InChIKey | QSZJRLUNCLHAKP-OLZOCXBDSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|