C22H33N5OS — CID 141223800
N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]-5-thiophen-2-ylpentanamide (PubChem CID 141223800) has the molecular formula C22H33N5OS and a molecular weight of 415.61 g/mol. Its IUPAC name is N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]-5-thiophen-2-ylpentanamide.
| Compound Name | N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 141223800 |
| Molecular Formula | C22H33N5OS |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]-5-thiophen-2-ylpentanamide |
| SMILES | Cc1nc(NC2CCC(NC(=O)CCCCc3cccs3)CC2)cc(N(C)C)n1 |
| InChI | InChI=1S/C22H33N5OS/c1-16-23-20(15-21(24-16)27(2)3)25-17-10-12-18(13-11-17)26-22(28)9-5-4-7-19-8-6-14-29-19/h6,8,14-15,17-18H,4-5,7,9-13H2,1-3H3,(H,26,28)(H,23,24,25) |
| InChIKey | LWJWPMCZHSSCFV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|