C14H23N5O2 — CID 68977621
[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]carbamic acid (PubChem CID 68977621) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is [4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]carbamic acid.
| Compound Name | [4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 68977621 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | [4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]carbamic acid |
| SMILES | Cc1nc(NC2CCC(NC(=O)O)CC2)cc(N(C)C)n1 |
| InChI | InChI=1S/C14H23N5O2/c1-9-15-12(8-13(16-9)19(2)3)17-10-4-6-11(7-5-10)18-14(20)21/h8,10-11,18H,4-7H2,1-3H3,(H,20,21)(H,15,16,17) |
| InChIKey | LTADSTIHQQWDNS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |