cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid

C12H21NO3 — CID 106320393

IUPACcis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid
SMILESCCCCCC(=O)N[C@H]1CC[C@@H](C(=O)O)C1
InChIInChI=1S/C12H21NO3/c1-2-3-4-5-11(14)13-10-7-6-9(8-10)12(15)16/h9-10H,2-8H2,1H3,(H,13,14)(H,15,16)/t9-,10+/m1/s1
InChIKeyZTUMWPCFZGERLE-ZJUUUORDSA-N
MW227.30 g/mol
LogP1.94
Rot. Bonds6

About cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid

cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid (PubChem CID 106320393) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid
PubChem CID106320393
Molecular FormulaC12H21NO3
Molecular Weight227.30 g/mol
Exact Mass227.15
IUPAC Namecis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid
SMILESCCCCCC(=O)N[C@H]1CC[C@@H](C(=O)O)C1
InChIInChI=1S/C12H21NO3/c1-2-3-4-5-11(14)13-10-7-6-9(8-10)12(15)16/h9-10H,2-8H2,1H3,(H,13,14)(H,15,16)/t9-,10+/m1/s1
InChIKeyZTUMWPCFZGERLE-ZJUUUORDSA-N
XLogP1.94
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.30
LogP ≤ 51.94
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid?
The IUPAC name of cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid (CID 106320393) is cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid?
The canonical SMILES for cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid is CCCCCC(=O)N[C@H]1CC[C@@H](C(=O)O)C1.
What is the InChIKey of cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid?
The InChIKey is ZTUMWPCFZGERLE-ZJUUUORDSA-N. The full InChI is InChI=1S/C12H21NO3/c1-2-3-4-5-11(14)13-10-7-6-9(8-10)12(15)16/h9-10H,2-8H2,1H3,(H,13,14)(H,15,16)/t9-,10+/m1/s1.
What are the key properties of cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid?
cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid has a molecular weight of 227.30 g/mol, XLogP of 1.94, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-3-(hexanoylamino)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 106320393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).