C11H20N2O3 — CID 106322808
cis-(1R,3S)-3-(5-aminopentanoylamino)cyclopentane-1-carboxylic acid (PubChem CID 106322808) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is cis-(1R,3S)-3-(5-aminopentanoylamino)cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3S)-3-(5-aminopentanoylamino)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 106322808 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | cis-(1R,3S)-3-(5-aminopentanoylamino)cyclopentane-1-carboxylic acid |
| SMILES | NCCCCC(=O)N[C@H]1CC[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C11H20N2O3/c12-6-2-1-3-10(14)13-9-5-4-8(7-9)11(15)16/h8-9H,1-7,12H2,(H,13,14)(H,15,16)/t8-,9+/m1/s1 |
| InChIKey | WDTZWQSIMOTGMT-BDAKNGLRSA-N |
| XLogP | 0.48 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|