C16H31N3O2 — CID 58615977
cis-(1S,3R)-3-(6-aminohexanoylamino)-N-(2-methylpropyl)cyclopentane-1-carboxamide (PubChem CID 58615977) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is cis-(1S,3R)-3-(6-aminohexanoylamino)-N-(2-methylpropyl)cyclopentane-1-carboxamide.
| Compound Name | cis-(1S,3R)-3-(6-aminohexanoylamino)-N-(2-methylpropyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 58615977 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | cis-(1S,3R)-3-(6-aminohexanoylamino)-N-(2-methylpropyl)cyclopentane-1-carboxamide |
| SMILES | CC(C)CNC(=O)[C@H]1CC[C@@H](NC(=O)CCCCCN)C1 |
| InChI | InChI=1S/C16H31N3O2/c1-12(2)11-18-16(21)13-7-8-14(10-13)19-15(20)6-4-3-5-9-17/h12-14H,3-11,17H2,1-2H3,(H,18,21)(H,19,20)/t13-,14+/m0/s1 |
| InChIKey | WJTKTGDFSAUAIU-UONOGXRCSA-N |
| XLogP | 1.56 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|