C13H23NO4 — CID 97338871
cis-(1S,3R)-3-[(2-pentoxyacetyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 97338871) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is cis-(1S,3R)-3-[(2-pentoxyacetyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[(2-pentoxyacetyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 97338871 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | cis-(1S,3R)-3-[(2-pentoxyacetyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | CCCCCOCC(=O)N[C@@H]1CC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C13H23NO4/c1-2-3-4-7-18-9-12(15)14-11-6-5-10(8-11)13(16)17/h10-11H,2-9H2,1H3,(H,14,15)(H,16,17)/t10-,11+/m0/s1 |
| InChIKey | APIZOCNVRYJEDA-WDEREUQCSA-N |
| XLogP | 1.56 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|