C16H21NO4 — CID 120676768
cis-(1S,3R)-3-[[2-(2-phenylethoxy)acetyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 120676768) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is cis-(1S,3R)-3-[[2-(2-phenylethoxy)acetyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[[2-(2-phenylethoxy)acetyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120676768 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | cis-(1S,3R)-3-[[2-(2-phenylethoxy)acetyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(COCCc1ccccc1)N[C@@H]1CC[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C16H21NO4/c18-15(17-14-7-6-13(10-14)16(19)20)11-21-9-8-12-4-2-1-3-5-12/h1-5,13-14H,6-11H2,(H,17,18)(H,19,20)/t13-,14+/m0/s1 |
| InChIKey | RIPOUAMGHAWGKA-UONOGXRCSA-N |
| XLogP | 1.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|