C17H20N2OS — CID 158834559
N-cyclopentyl-2-phenyl-N-(1,3-thiazol-2-ylmethyl)acetamide (PubChem CID 158834559) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is N-cyclopentyl-2-phenyl-N-(1,3-thiazol-2-ylmethyl)acetamide.
| Compound Name | N-cyclopentyl-2-phenyl-N-(1,3-thiazol-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 158834559 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | N-cyclopentyl-2-phenyl-N-(1,3-thiazol-2-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccccc1)N(Cc1nccs1)C1CCCC1 |
| InChI | InChI=1S/C17H20N2OS/c20-17(12-14-6-2-1-3-7-14)19(15-8-4-5-9-15)13-16-18-10-11-21-16/h1-3,6-7,10-11,15H,4-5,8-9,12-13H2 |
| InChIKey | IXLVASOJHAYOMF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |